C8H4ClNO3S — CID 84692997
5-chloro-2-oxo-3H-1,3-benzothiazole-7-carboxylic acid (PubChem CID 84692997) has the molecular formula C8H4ClNO3S and a molecular weight of 229.64 g/mol. Its IUPAC name is 5-chloro-2-oxo-3H-1,3-benzothiazole-7-carboxylic acid.
| Compound Name | 5-chloro-2-oxo-3H-1,3-benzothiazole-7-carboxylic acid |
|---|---|
| PubChem CID | 84692997 |
| Molecular Formula | C8H4ClNO3S |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 5-chloro-2-oxo-3H-1,3-benzothiazole-7-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cc2[nH]c(=O)sc12 |
| InChI | InChI=1S/C8H4ClNO3S/c9-3-1-4(7(11)12)6-5(2-3)10-8(13)14-6/h1-2H,(H,10,13)(H,11,12) |
| InChIKey | VDVMWSYOJFUBPS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |