C7H11F3O3S — CID 84695375
1-(1,1-dioxothian-4-yl)-2,2,2-trifluoroethanol (PubChem CID 84695375) has the molecular formula C7H11F3O3S and a molecular weight of 232.22 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(1,1-dioxothian-4-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 84695375 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-2,2,2-trifluoroethanol |
| SMILES | O=S1(=O)CCC(C(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11F3O3S/c8-7(9,10)6(11)5-1-3-14(12,13)4-2-5/h5-6,11H,1-4H2 |
| InChIKey | CGFWWPFXJBQRRL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |