C14H20N2O — CID 84695936
1-methyl-6-(pyrrolidin-3-ylmethoxy)-2,3-dihydroindole (PubChem CID 84695936) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-methyl-6-(pyrrolidin-3-ylmethoxy)-2,3-dihydroindole.
| Compound Name | 1-methyl-6-(pyrrolidin-3-ylmethoxy)-2,3-dihydroindole |
|---|---|
| PubChem CID | 84695936 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-methyl-6-(pyrrolidin-3-ylmethoxy)-2,3-dihydroindole |
| SMILES | CN1CCc2ccc(OCC3CCNC3)cc21 |
| InChI | InChI=1S/C14H20N2O/c1-16-7-5-12-2-3-13(8-14(12)16)17-10-11-4-6-15-9-11/h2-3,8,11,15H,4-7,9-10H2,1H3 |
| InChIKey | KPEPIIGAHZNXNN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |