About 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene
1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene (PubChem CID 84696330) has the molecular formula C9H10BrFO
and a molecular weight of 233.08 g/mol. Its IUPAC name is 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene |
| PubChem CID | 84696330 |
| Molecular Formula | C9H10BrFO |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene |
| SMILES | COc1c(C)c(F)cc(Br)c1C |
| InChI | InChI=1S/C9H10BrFO/c1-5-7(10)4-8(11)6(2)9(5)12-3/h4H,1-3H3 |
| InChIKey | NYHAQFCDFIHEFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene?
The IUPAC name of 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene (CID 84696330) is 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene.
What is the SMILES notation for 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene?
The canonical SMILES for 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene is COc1c(C)c(F)cc(Br)c1C.
What is the InChIKey of 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene?
The InChIKey is NYHAQFCDFIHEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrFO/c1-5-7(10)4-8(11)6(2)9(5)12-3/h4H,1-3H3.
What are the key properties of 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene?
1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene has a molecular weight of 233.08 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5-fluoro-3-methoxy-2,4-dimethylbenzene is sourced from PubChem (CID 84696330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).