1,7-dimethoxyisoquinoline-4-carboxylic acid

C12H11NO4 — CID 84696458

IUPAC1,7-dimethoxyisoquinoline-4-carboxylic acid
SMILESCOc1ccc2c(C(=O)O)cnc(OC)c2c1
InChIInChI=1S/C12H11NO4/c1-16-7-3-4-8-9(5-7)11(17-2)13-6-10(8)12(14)15/h3-6H,1-2H3,(H,14,15)
InChIKeyQOJNXWVZZMAJCG-UHFFFAOYSA-N
MW233.22 g/mol
LogP1.95
Rot. Bonds3

About 1,7-dimethoxyisoquinoline-4-carboxylic acid

1,7-dimethoxyisoquinoline-4-carboxylic acid (PubChem CID 84696458) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 1,7-dimethoxyisoquinoline-4-carboxylic acid.

Molecular Properties

Compound Name1,7-dimethoxyisoquinoline-4-carboxylic acid
PubChem CID84696458
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name1,7-dimethoxyisoquinoline-4-carboxylic acid
SMILESCOc1ccc2c(C(=O)O)cnc(OC)c2c1
InChIInChI=1S/C12H11NO4/c1-16-7-3-4-8-9(5-7)11(17-2)13-6-10(8)12(14)15/h3-6H,1-2H3,(H,14,15)
InChIKeyQOJNXWVZZMAJCG-UHFFFAOYSA-N
XLogP1.95
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,7-dimethoxyisoquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,7-dimethoxyisoquinoline-4-carboxylic acid?
The IUPAC name of 1,7-dimethoxyisoquinoline-4-carboxylic acid (CID 84696458) is 1,7-dimethoxyisoquinoline-4-carboxylic acid.
What is the SMILES notation for 1,7-dimethoxyisoquinoline-4-carboxylic acid?
The canonical SMILES for 1,7-dimethoxyisoquinoline-4-carboxylic acid is COc1ccc2c(C(=O)O)cnc(OC)c2c1.
What is the InChIKey of 1,7-dimethoxyisoquinoline-4-carboxylic acid?
The InChIKey is QOJNXWVZZMAJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-16-7-3-4-8-9(5-7)11(17-2)13-6-10(8)12(14)15/h3-6H,1-2H3,(H,14,15).
What are the key properties of 1,7-dimethoxyisoquinoline-4-carboxylic acid?
1,7-dimethoxyisoquinoline-4-carboxylic acid has a molecular weight of 233.22 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethoxyisoquinoline-4-carboxylic acid is sourced from PubChem (CID 84696458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).