C12H11NO4 — CID 84696458
1,7-dimethoxyisoquinoline-4-carboxylic acid (PubChem CID 84696458) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 1,7-dimethoxyisoquinoline-4-carboxylic acid.
| Compound Name | 1,7-dimethoxyisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 84696458 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1,7-dimethoxyisoquinoline-4-carboxylic acid |
| SMILES | COc1ccc2c(C(=O)O)cnc(OC)c2c1 |
| InChI | InChI=1S/C12H11NO4/c1-16-7-3-4-8-9(5-7)11(17-2)13-6-10(8)12(14)15/h3-6H,1-2H3,(H,14,15) |
| InChIKey | QOJNXWVZZMAJCG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |