About 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid
3-(2-bromo-1,3-oxazol-5-yl)butanoic acid (PubChem CID 84697303) has the molecular formula C7H8BrNO3
and a molecular weight of 234.05 g/mol. Its IUPAC name is 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid |
| PubChem CID | 84697303 |
| Molecular Formula | C7H8BrNO3 |
| Molecular Weight | 234.05 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1cnc(Br)o1 |
| InChI | InChI=1S/C7H8BrNO3/c1-4(2-6(10)11)5-3-9-7(8)12-5/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | GDCZCZTYLVJJRS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid?
The IUPAC name of 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid (CID 84697303) is 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid.
What is the SMILES notation for 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid?
The canonical SMILES for 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid is CC(CC(=O)O)c1cnc(Br)o1.
What is the InChIKey of 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid?
The InChIKey is GDCZCZTYLVJJRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO3/c1-4(2-6(10)11)5-3-9-7(8)12-5/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid?
3-(2-bromo-1,3-oxazol-5-yl)butanoic acid has a molecular weight of 234.05 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-1,3-oxazol-5-yl)butanoic acid is sourced from PubChem (CID 84697303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).