About spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one
spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one (PubChem CID 84697857) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one.
Molecular Properties
| Compound Name | spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one |
| PubChem CID | 84697857 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one |
| SMILES | O=C1Nc2ccccc2NC12CCSCC2 |
| InChI | InChI=1S/C12H14N2OS/c15-11-12(5-7-16-8-6-12)14-10-4-2-1-3-9(10)13-11/h1-4,14H,5-8H2,(H,13,15) |
| InChIKey | SDYFGZWDTPFIPQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one?
The IUPAC name of spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one (CID 84697857) is spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one.
What is the SMILES notation for spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one?
The canonical SMILES for spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one is O=C1Nc2ccccc2NC12CCSCC2.
What is the InChIKey of spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one?
The InChIKey is SDYFGZWDTPFIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c15-11-12(5-7-16-8-6-12)14-10-4-2-1-3-9(10)13-11/h1-4,14H,5-8H2,(H,13,15).
What are the key properties of spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one?
spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one has a molecular weight of 234.32 g/mol, XLogP of 2.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-one is sourced from PubChem (CID 84697857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).