C11H19F2NO2 — CID 84698559
2-[1-(3,3-difluorobutyl)piperidin-4-yl]acetic acid (PubChem CID 84698559) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-[1-(3,3-difluorobutyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(3,3-difluorobutyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 84698559 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[1-(3,3-difluorobutyl)piperidin-4-yl]acetic acid |
| SMILES | CC(F)(F)CCN1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H19F2NO2/c1-11(12,13)4-7-14-5-2-9(3-6-14)8-10(15)16/h9H,2-8H2,1H3,(H,15,16) |
| InChIKey | HYBNKDBHHCQDQF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |