C14H21NO2 — CID 84698765
2-methoxy-3,6-dimethyl-4-piperidin-2-ylphenol (PubChem CID 84698765) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-methoxy-3,6-dimethyl-4-piperidin-2-ylphenol.
| Compound Name | 2-methoxy-3,6-dimethyl-4-piperidin-2-ylphenol |
|---|---|
| PubChem CID | 84698765 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-methoxy-3,6-dimethyl-4-piperidin-2-ylphenol |
| SMILES | COc1c(C)c(C2CCCCN2)cc(C)c1O |
| InChI | InChI=1S/C14H21NO2/c1-9-8-11(12-6-4-5-7-15-12)10(2)14(17-3)13(9)16/h8,12,15-16H,4-7H2,1-3H3 |
| InChIKey | CSIDKAFTEWKJNE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |