3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid

C13H16O4 — CID 84699356

IUPAC3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid
SMILESCc1c(CCC(=O)O)ccc2c1OCCCO2
InChIInChI=1S/C13H16O4/c1-9-10(4-6-12(14)15)3-5-11-13(9)17-8-2-7-16-11/h3,5H,2,4,6-8H2,1H3,(H,14,15)
InChIKeyUPNYPWKJLDZRDE-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.17
Rot. Bonds3

About 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid

3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid (PubChem CID 84699356) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid.

Molecular Properties

Compound Name3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid
PubChem CID84699356
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Name3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid
SMILESCc1c(CCC(=O)O)ccc2c1OCCCO2
InChIInChI=1S/C13H16O4/c1-9-10(4-6-12(14)15)3-5-11-13(9)17-8-2-7-16-11/h3,5H,2,4,6-8H2,1H3,(H,14,15)
InChIKeyUPNYPWKJLDZRDE-UHFFFAOYSA-N
XLogP2.17
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid?
The IUPAC name of 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid (CID 84699356) is 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid.
What is the SMILES notation for 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid?
The canonical SMILES for 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid is Cc1c(CCC(=O)O)ccc2c1OCCCO2.
What is the InChIKey of 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid?
The InChIKey is UPNYPWKJLDZRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-9-10(4-6-12(14)15)3-5-11-13(9)17-8-2-7-16-11/h3,5H,2,4,6-8H2,1H3,(H,14,15).
What are the key properties of 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid?
3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid has a molecular weight of 236.27 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoic acid is sourced from PubChem (CID 84699356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).