About 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol
4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol (PubChem CID 84700466) has the molecular formula C13H16ClNO
and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol.
Molecular Properties
| Compound Name | 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol |
| PubChem CID | 84700466 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol |
| SMILES | Oc1ccc2c(c1Cl)CC(C1CCCC1)N2 |
| InChI | InChI=1S/C13H16ClNO/c14-13-9-7-11(8-3-1-2-4-8)15-10(9)5-6-12(13)16/h5-6,8,11,15-16H,1-4,7H2 |
| InChIKey | SUXVZEFJOGVUTA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol?
The IUPAC name of 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol (CID 84700466) is 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol.
What is the SMILES notation for 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol?
The canonical SMILES for 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol is Oc1ccc2c(c1Cl)CC(C1CCCC1)N2.
What is the InChIKey of 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol?
The InChIKey is SUXVZEFJOGVUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO/c14-13-9-7-11(8-3-1-2-4-8)15-10(9)5-6-12(13)16/h5-6,8,11,15-16H,1-4,7H2.
What are the key properties of 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol?
4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol has a molecular weight of 237.73 g/mol, XLogP of 3.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyclopentyl-2,3-dihydro-1H-indol-5-ol is sourced from PubChem (CID 84700466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).