C13H18O4 — CID 84700687
[2-methoxy-3-(oxan-3-yloxy)phenyl]methanol (PubChem CID 84700687) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is [2-methoxy-3-(oxan-3-yloxy)phenyl]methanol.
| Compound Name | [2-methoxy-3-(oxan-3-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 84700687 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [2-methoxy-3-(oxan-3-yloxy)phenyl]methanol |
| SMILES | COc1c(CO)cccc1OC1CCCOC1 |
| InChI | InChI=1S/C13H18O4/c1-15-13-10(8-14)4-2-6-12(13)17-11-5-3-7-16-9-11/h2,4,6,11,14H,3,5,7-9H2,1H3 |
| InChIKey | RSMAJESYZAHPRW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |