About 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid
3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 84700834) has the molecular formula C9H7ClN4O2
and a molecular weight of 238.63 g/mol. Its IUPAC name is 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid |
| PubChem CID | 84700834 |
| Molecular Formula | C9H7ClN4O2 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C9H7ClN4O2/c10-6-1-5(9(15)16)2-7(11)8(6)14-4-12-3-13-14/h1-4H,11H2,(H,15,16) |
| InChIKey | YUJRKNHRFZIHLM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid?
The IUPAC name of 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid (CID 84700834) is 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid.
What is the SMILES notation for 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid?
The canonical SMILES for 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid is Nc1cc(C(=O)O)cc(Cl)c1-n1cncn1.
What is the InChIKey of 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid?
The InChIKey is YUJRKNHRFZIHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN4O2/c10-6-1-5(9(15)16)2-7(11)8(6)14-4-12-3-13-14/h1-4H,11H2,(H,15,16).
What are the key properties of 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid?
3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid has a molecular weight of 238.63 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid is sourced from PubChem (CID 84700834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).