C9H7ClN4O2 — CID 84700834
3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 84700834) has the molecular formula C9H7ClN4O2 and a molecular weight of 238.63 g/mol. Its IUPAC name is 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid.
| Compound Name | 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 84700834 |
| Molecular Formula | C9H7ClN4O2 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-amino-5-chloro-4-(1,2,4-triazol-1-yl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C9H7ClN4O2/c10-6-1-5(9(15)16)2-7(11)8(6)14-4-12-3-13-14/h1-4H,11H2,(H,15,16) |
| InChIKey | YUJRKNHRFZIHLM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|