About 6-chloro-2,3-dimethylbenzenesulfonyl chloride
6-chloro-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 84701104) has the molecular formula C8H8Cl2O2S
and a molecular weight of 239.12 g/mol. Its IUPAC name is 6-chloro-2,3-dimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-2,3-dimethylbenzenesulfonyl chloride |
| PubChem CID | 84701104 |
| Molecular Formula | C8H8Cl2O2S |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 6-chloro-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1ccc(Cl)c(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C8H8Cl2O2S/c1-5-3-4-7(9)8(6(5)2)13(10,11)12/h3-4H,1-2H3 |
| InChIKey | SNYAKKPTCKWNAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2,3-dimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dimethylbenzenesulfonyl chloride?
The IUPAC name of 6-chloro-2,3-dimethylbenzenesulfonyl chloride (CID 84701104) is 6-chloro-2,3-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 6-chloro-2,3-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 6-chloro-2,3-dimethylbenzenesulfonyl chloride is Cc1ccc(Cl)c(S(=O)(=O)Cl)c1C.
What is the InChIKey of 6-chloro-2,3-dimethylbenzenesulfonyl chloride?
The InChIKey is SNYAKKPTCKWNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O2S/c1-5-3-4-7(9)8(6(5)2)13(10,11)12/h3-4H,1-2H3.
What are the key properties of 6-chloro-2,3-dimethylbenzenesulfonyl chloride?
6-chloro-2,3-dimethylbenzenesulfonyl chloride has a molecular weight of 239.12 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 84701104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).