About 4-bromo-N,1-dimethylindazol-3-amine
4-bromo-N,1-dimethylindazol-3-amine (PubChem CID 84701824) has the molecular formula C9H10BrN3
and a molecular weight of 240.10 g/mol. Its IUPAC name is 4-bromo-N,1-dimethylindazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-N,1-dimethylindazol-3-amine |
| PubChem CID | 84701824 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 4-bromo-N,1-dimethylindazol-3-amine |
| SMILES | CNc1nn(C)c2cccc(Br)c12 |
| InChI | InChI=1S/C9H10BrN3/c1-11-9-8-6(10)4-3-5-7(8)13(2)12-9/h3-5H,1-2H3,(H,11,12) |
| InChIKey | GDMSDTSRPUCMPV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N,1-dimethylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,1-dimethylindazol-3-amine?
The IUPAC name of 4-bromo-N,1-dimethylindazol-3-amine (CID 84701824) is 4-bromo-N,1-dimethylindazol-3-amine.
What is the SMILES notation for 4-bromo-N,1-dimethylindazol-3-amine?
The canonical SMILES for 4-bromo-N,1-dimethylindazol-3-amine is CNc1nn(C)c2cccc(Br)c12.
What is the InChIKey of 4-bromo-N,1-dimethylindazol-3-amine?
The InChIKey is GDMSDTSRPUCMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3/c1-11-9-8-6(10)4-3-5-7(8)13(2)12-9/h3-5H,1-2H3,(H,11,12).
What are the key properties of 4-bromo-N,1-dimethylindazol-3-amine?
4-bromo-N,1-dimethylindazol-3-amine has a molecular weight of 240.10 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,1-dimethylindazol-3-amine is sourced from PubChem (CID 84701824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).