About 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine
1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine (PubChem CID 84702380) has the molecular formula C8H9BrN4
and a molecular weight of 241.09 g/mol. Its IUPAC name is 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine |
| PubChem CID | 84702380 |
| Molecular Formula | C8H9BrN4 |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine |
| SMILES | CC(N)c1cnc2c(Br)cncn12 |
| InChI | InChI=1S/C8H9BrN4/c1-5(10)7-3-12-8-6(9)2-11-4-13(7)8/h2-5H,10H2,1H3 |
| InChIKey | AFUHBYDTAZIANL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine?
The IUPAC name of 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine (CID 84702380) is 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine.
What is the SMILES notation for 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine?
The canonical SMILES for 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine is CC(N)c1cnc2c(Br)cncn12.
What is the InChIKey of 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine?
The InChIKey is AFUHBYDTAZIANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN4/c1-5(10)7-3-12-8-6(9)2-11-4-13(7)8/h2-5H,10H2,1H3.
What are the key properties of 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine?
1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine has a molecular weight of 241.09 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-bromoimidazo[1,2-c]pyrimidin-3-yl)ethanamine is sourced from PubChem (CID 84702380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).