C9H5BrFNO — CID 84703029
5-bromo-4-(3-fluorophenyl)-1,2-oxazole (PubChem CID 84703029) has the molecular formula C9H5BrFNO and a molecular weight of 242.05 g/mol. Its IUPAC name is 5-bromo-4-(3-fluorophenyl)-1,2-oxazole.
| Compound Name | 5-bromo-4-(3-fluorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 84703029 |
| Molecular Formula | C9H5BrFNO |
| Molecular Weight | 242.05 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | 5-bromo-4-(3-fluorophenyl)-1,2-oxazole |
| SMILES | Fc1cccc(-c2cnoc2Br)c1 |
| InChI | InChI=1S/C9H5BrFNO/c10-9-8(5-12-13-9)6-2-1-3-7(11)4-6/h1-5H |
| InChIKey | VSRMLTMUWFNIPR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.05 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |