About 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol
7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 84703157) has the molecular formula C10H12BrNO
and a molecular weight of 242.12 g/mol. Its IUPAC name is 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
Molecular Properties
| Compound Name | 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| PubChem CID | 84703157 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | CN1CCc2cc(O)c(Br)cc2C1 |
| InChI | InChI=1S/C10H12BrNO/c1-12-3-2-7-5-10(13)9(11)4-8(7)6-12/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | QRQMVCZJTWLYNJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The IUPAC name of 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (CID 84703157) is 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
What is the SMILES notation for 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The canonical SMILES for 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol is CN1CCc2cc(O)c(Br)cc2C1.
What is the InChIKey of 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
The InChIKey is QRQMVCZJTWLYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO/c1-12-3-2-7-5-10(13)9(11)4-8(7)6-12/h4-5,13H,2-3,6H2,1H3.
What are the key properties of 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol?
7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol has a molecular weight of 242.12 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol is sourced from PubChem (CID 84703157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).