4-chloro-3,5-difluorobenzenesulfonyl chloride

C6H2Cl2F2O2S — CID 84705948

IUPAC4-chloro-3,5-difluorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(F)c(Cl)c(F)c1
InChIInChI=1S/C6H2Cl2F2O2S/c7-6-4(9)1-3(2-5(6)10)13(8,11)12/h1-2H
InChIKeyKAHGIUIIJGMIDP-UHFFFAOYSA-N
MW247.05 g/mol
LogP2.55
Rot. Bonds1

About 4-chloro-3,5-difluorobenzenesulfonyl chloride

4-chloro-3,5-difluorobenzenesulfonyl chloride (PubChem CID 84705948) has the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. Its IUPAC name is 4-chloro-3,5-difluorobenzenesulfonyl chloride.

Molecular Properties

Compound Name4-chloro-3,5-difluorobenzenesulfonyl chloride
PubChem CID84705948
Molecular FormulaC6H2Cl2F2O2S
Molecular Weight247.05 g/mol
Exact Mass245.91
IUPAC Name4-chloro-3,5-difluorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(F)c(Cl)c(F)c1
InChIInChI=1S/C6H2Cl2F2O2S/c7-6-4(9)1-3(2-5(6)10)13(8,11)12/h1-2H
InChIKeyKAHGIUIIJGMIDP-UHFFFAOYSA-N
XLogP2.55
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.05
LogP ≤ 52.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 4-chloro-3,5-difluorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3,5-difluorobenzenesulfonyl chloride?
The IUPAC name of 4-chloro-3,5-difluorobenzenesulfonyl chloride (CID 84705948) is 4-chloro-3,5-difluorobenzenesulfonyl chloride.
What is the SMILES notation for 4-chloro-3,5-difluorobenzenesulfonyl chloride?
The canonical SMILES for 4-chloro-3,5-difluorobenzenesulfonyl chloride is O=S(=O)(Cl)c1cc(F)c(Cl)c(F)c1.
What is the InChIKey of 4-chloro-3,5-difluorobenzenesulfonyl chloride?
The InChIKey is KAHGIUIIJGMIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2F2O2S/c7-6-4(9)1-3(2-5(6)10)13(8,11)12/h1-2H.
What are the key properties of 4-chloro-3,5-difluorobenzenesulfonyl chloride?
4-chloro-3,5-difluorobenzenesulfonyl chloride has a molecular weight of 247.05 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-difluorobenzenesulfonyl chloride is sourced from PubChem (CID 84705948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).