C11H12BrNO — CID 84708148
7-bromo-1,3,4,4a,5,9b-hexahydropyrano[4,3-b]indole (PubChem CID 84708148) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is 7-bromo-1,3,4,4a,5,9b-hexahydropyrano[4,3-b]indole.
| Compound Name | 7-bromo-1,3,4,4a,5,9b-hexahydropyrano[4,3-b]indole |
|---|---|
| PubChem CID | 84708148 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 7-bromo-1,3,4,4a,5,9b-hexahydropyrano[4,3-b]indole |
| SMILES | Brc1ccc2c(c1)NC1CCOCC21 |
| InChI | InChI=1S/C11H12BrNO/c12-7-1-2-8-9-6-14-4-3-10(9)13-11(8)5-7/h1-2,5,9-10,13H,3-4,6H2 |
| InChIKey | MGJHBLUNWBBBSG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |