C11H14BrNO — CID 84708836
1-(6-bromo-2,3-dimethylphenyl)-2-(methylamino)ethanone (PubChem CID 84708836) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 1-(6-bromo-2,3-dimethylphenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(6-bromo-2,3-dimethylphenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 84708836 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1-(6-bromo-2,3-dimethylphenyl)-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1c(Br)ccc(C)c1C |
| InChI | InChI=1S/C11H14BrNO/c1-7-4-5-9(12)11(8(7)2)10(14)6-13-3/h4-5,13H,6H2,1-3H3 |
| InChIKey | BZJJCADDBCUWIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |