About 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole
5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole (PubChem CID 84710058) has the molecular formula C9H7BrFNS
and a molecular weight of 260.13 g/mol. Its IUPAC name is 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole |
| PubChem CID | 84710058 |
| Molecular Formula | C9H7BrFNS |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole |
| SMILES | CC(F)c1nsc2ccc(Br)cc12 |
| InChI | InChI=1S/C9H7BrFNS/c1-5(11)9-7-4-6(10)2-3-8(7)13-12-9/h2-5H,1H3 |
| InChIKey | ICUMAXMRYQUYLQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole?
The IUPAC name of 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole (CID 84710058) is 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole.
What is the SMILES notation for 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole?
The canonical SMILES for 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole is CC(F)c1nsc2ccc(Br)cc12.
What is the InChIKey of 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole?
The InChIKey is ICUMAXMRYQUYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNS/c1-5(11)9-7-4-6(10)2-3-8(7)13-12-9/h2-5H,1H3.
What are the key properties of 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole?
5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole has a molecular weight of 260.13 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1-fluoroethyl)-1,2-benzothiazole is sourced from PubChem (CID 84710058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).