C11H15ClO3S — CID 84710908
2-(2-methoxy-3,6-dimethylphenyl)ethanesulfonyl chloride (PubChem CID 84710908) has the molecular formula C11H15ClO3S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-(2-methoxy-3,6-dimethylphenyl)ethanesulfonyl chloride.
| Compound Name | 2-(2-methoxy-3,6-dimethylphenyl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 84710908 |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(2-methoxy-3,6-dimethylphenyl)ethanesulfonyl chloride |
| SMILES | COc1c(C)ccc(C)c1CCS(=O)(=O)Cl |
| InChI | InChI=1S/C11H15ClO3S/c1-8-4-5-9(2)11(15-3)10(8)6-7-16(12,13)14/h4-5H,6-7H2,1-3H3 |
| InChIKey | RDBWLWQJWBSUFD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |