About (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride
(2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride (PubChem CID 84710918) has the molecular formula C10H11ClO2S2
and a molecular weight of 262.78 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride |
| PubChem CID | 84710918 |
| Molecular Formula | C10H11ClO2S2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride |
| SMILES | CC1Cc2c(CS(=O)(=O)Cl)cccc2S1 |
| InChI | InChI=1S/C10H11ClO2S2/c1-7-5-9-8(6-15(11,12)13)3-2-4-10(9)14-7/h2-4,7H,5-6H2,1H3 |
| InChIKey | MUFNMVSXFOPKGY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride?
The IUPAC name of (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride (CID 84710918) is (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride.
What is the SMILES notation for (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride?
The canonical SMILES for (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride is CC1Cc2c(CS(=O)(=O)Cl)cccc2S1.
What is the InChIKey of (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride?
The InChIKey is MUFNMVSXFOPKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2S2/c1-7-5-9-8(6-15(11,12)13)3-2-4-10(9)14-7/h2-4,7H,5-6H2,1H3.
What are the key properties of (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride?
(2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride has a molecular weight of 262.78 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydro-1-benzothiophen-4-yl)methanesulfonyl chloride is sourced from PubChem (CID 84710918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).