About 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline
6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline (PubChem CID 84711609) has the molecular formula C13H16BrN
and a molecular weight of 266.18 g/mol. Its IUPAC name is 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 84711609 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Brc1ccc2c(c1)CCN(C1CCC1)C2 |
| InChI | InChI=1S/C13H16BrN/c14-12-5-4-11-9-15(13-2-1-3-13)7-6-10(11)8-12/h4-5,8,13H,1-3,6-7,9H2 |
| InChIKey | JNTDEJCNXWVKEM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline (CID 84711609) is 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline is Brc1ccc2c(c1)CCN(C1CCC1)C2.
What is the InChIKey of 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is JNTDEJCNXWVKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN/c14-12-5-4-11-9-15(13-2-1-3-13)7-6-10(11)8-12/h4-5,8,13H,1-3,6-7,9H2.
What are the key properties of 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline?
6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 266.18 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-cyclobutyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 84711609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).