C9H8ClF3O2S — CID 84713401
[3-(2,2,2-trifluoroethyl)phenyl]methanesulfonyl chloride (PubChem CID 84713401) has the molecular formula C9H8ClF3O2S and a molecular weight of 272.68 g/mol. Its IUPAC name is [3-(2,2,2-trifluoroethyl)phenyl]methanesulfonyl chloride.
| Compound Name | [3-(2,2,2-trifluoroethyl)phenyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 84713401 |
| Molecular Formula | C9H8ClF3O2S |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | [3-(2,2,2-trifluoroethyl)phenyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8ClF3O2S/c10-16(14,15)6-8-3-1-2-7(4-8)5-9(11,12)13/h1-4H,5-6H2 |
| InChIKey | GRNFYXHRFPZDSK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |