About 3-bromo-6-chloro-1,2-dimethylindol-5-amine
3-bromo-6-chloro-1,2-dimethylindol-5-amine (PubChem CID 84713656) has the molecular formula C10H10BrClN2
and a molecular weight of 273.56 g/mol. Its IUPAC name is 3-bromo-6-chloro-1,2-dimethylindol-5-amine.
Molecular Properties
| Compound Name | 3-bromo-6-chloro-1,2-dimethylindol-5-amine |
| PubChem CID | 84713656 |
| Molecular Formula | C10H10BrClN2 |
| Molecular Weight | 273.56 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 3-bromo-6-chloro-1,2-dimethylindol-5-amine |
| SMILES | Cc1c(Br)c2cc(N)c(Cl)cc2n1C |
| InChI | InChI=1S/C10H10BrClN2/c1-5-10(11)6-3-8(13)7(12)4-9(6)14(5)2/h3-4H,13H2,1-2H3 |
| InChIKey | BTOHQGYYZWKSIB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-6-chloro-1,2-dimethylindol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-chloro-1,2-dimethylindol-5-amine?
The IUPAC name of 3-bromo-6-chloro-1,2-dimethylindol-5-amine (CID 84713656) is 3-bromo-6-chloro-1,2-dimethylindol-5-amine.
What is the SMILES notation for 3-bromo-6-chloro-1,2-dimethylindol-5-amine?
The canonical SMILES for 3-bromo-6-chloro-1,2-dimethylindol-5-amine is Cc1c(Br)c2cc(N)c(Cl)cc2n1C.
What is the InChIKey of 3-bromo-6-chloro-1,2-dimethylindol-5-amine?
The InChIKey is BTOHQGYYZWKSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClN2/c1-5-10(11)6-3-8(13)7(12)4-9(6)14(5)2/h3-4H,13H2,1-2H3.
What are the key properties of 3-bromo-6-chloro-1,2-dimethylindol-5-amine?
3-bromo-6-chloro-1,2-dimethylindol-5-amine has a molecular weight of 273.56 g/mol, XLogP of 3.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-chloro-1,2-dimethylindol-5-amine is sourced from PubChem (CID 84713656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).