C11H12BrFO2 — CID 84714116
3-(3-bromo-4-fluoro-5-methylphenyl)-2-methylpropanoic acid (PubChem CID 84714116) has the molecular formula C11H12BrFO2 and a molecular weight of 275.12 g/mol. Its IUPAC name is 3-(3-bromo-4-fluoro-5-methylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(3-bromo-4-fluoro-5-methylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84714116 |
| Molecular Formula | C11H12BrFO2 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-(3-bromo-4-fluoro-5-methylphenyl)-2-methylpropanoic acid |
| SMILES | Cc1cc(CC(C)C(=O)O)cc(Br)c1F |
| InChI | InChI=1S/C11H12BrFO2/c1-6-3-8(4-7(2)11(14)15)5-9(12)10(6)13/h3,5,7H,4H2,1-2H3,(H,14,15) |
| InChIKey | YIOFVSRQQDAGIT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |