C10H11BrFNO2 — CID 84714296
4-amino-3-(4-bromo-2-fluorophenyl)butanoic acid (PubChem CID 84714296) has the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. Its IUPAC name is 4-amino-3-(4-bromo-2-fluorophenyl)butanoic acid.
| Compound Name | 4-amino-3-(4-bromo-2-fluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 84714296 |
| Molecular Formula | C10H11BrFNO2 |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 4-amino-3-(4-bromo-2-fluorophenyl)butanoic acid |
| SMILES | NCC(CC(=O)O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H11BrFNO2/c11-7-1-2-8(9(12)4-7)6(5-13)3-10(14)15/h1-2,4,6H,3,5,13H2,(H,14,15) |
| InChIKey | KCXMIHXTUFKQPI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |