About 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole
5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole (PubChem CID 84714719) has the molecular formula C9H6BrF2NS
and a molecular weight of 278.12 g/mol. Its IUPAC name is 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole |
| PubChem CID | 84714719 |
| Molecular Formula | C9H6BrF2NS |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole |
| SMILES | CC(F)(F)c1nsc2ccc(Br)cc12 |
| InChI | InChI=1S/C9H6BrF2NS/c1-9(11,12)8-6-4-5(10)2-3-7(6)14-13-8/h2-4H,1H3 |
| InChIKey | PZUYBIRFAYIAGO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole?
The IUPAC name of 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole (CID 84714719) is 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole.
What is the SMILES notation for 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole?
The canonical SMILES for 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole is CC(F)(F)c1nsc2ccc(Br)cc12.
What is the InChIKey of 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole?
The InChIKey is PZUYBIRFAYIAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF2NS/c1-9(11,12)8-6-4-5(10)2-3-7(6)14-13-8/h2-4H,1H3.
What are the key properties of 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole?
5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole has a molecular weight of 278.12 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1,1-difluoroethyl)-1,2-benzothiazole is sourced from PubChem (CID 84714719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).