About 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol
2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol (PubChem CID 84715006) has the molecular formula C9H11BrOS2
and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol.
Molecular Properties
| Compound Name | 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol |
| PubChem CID | 84715006 |
| Molecular Formula | C9H11BrOS2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol |
| SMILES | CSc1cc(C)c(SC)c(Br)c1O |
| InChI | InChI=1S/C9H11BrOS2/c1-5-4-6(12-2)8(11)7(10)9(5)13-3/h4,11H,1-3H3 |
| InChIKey | LKOOJTUKURKEPM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol?
The IUPAC name of 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol (CID 84715006) is 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol.
What is the SMILES notation for 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol?
The canonical SMILES for 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol is CSc1cc(C)c(SC)c(Br)c1O.
What is the InChIKey of 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol?
The InChIKey is LKOOJTUKURKEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrOS2/c1-5-4-6(12-2)8(11)7(10)9(5)13-3/h4,11H,1-3H3.
What are the key properties of 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol?
2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol has a molecular weight of 279.22 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methyl-3,6-bis(methylsulfanyl)phenol is sourced from PubChem (CID 84715006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).