About 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol
4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol (PubChem CID 84715015) has the molecular formula C9H8BrClO3
and a molecular weight of 279.52 g/mol. Its IUPAC name is 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol |
| PubChem CID | 84715015 |
| Molecular Formula | C9H8BrClO3 |
| Molecular Weight | 279.52 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol |
| SMILES | CC1(C)Oc2cc(Cl)c(O)c(Br)c2O1 |
| InChI | InChI=1S/C9H8BrClO3/c1-9(2)13-5-3-4(11)7(12)6(10)8(5)14-9/h3,12H,1-2H3 |
| InChIKey | GIVPJWSTGFENDV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol?
The IUPAC name of 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol (CID 84715015) is 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol.
What is the SMILES notation for 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol?
The canonical SMILES for 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol is CC1(C)Oc2cc(Cl)c(O)c(Br)c2O1.
What is the InChIKey of 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol?
The InChIKey is GIVPJWSTGFENDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClO3/c1-9(2)13-5-3-4(11)7(12)6(10)8(5)14-9/h3,12H,1-2H3.
What are the key properties of 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol?
4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol has a molecular weight of 279.52 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-chloro-2,2-dimethyl-1,3-benzodioxol-5-ol is sourced from PubChem (CID 84715015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).