About 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine
3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 84715127) has the molecular formula C6H3BrCl2N4
and a molecular weight of 281.93 g/mol. Its IUPAC name is 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine |
| PubChem CID | 84715127 |
| Molecular Formula | C6H3BrCl2N4 |
| Molecular Weight | 281.93 g/mol |
| Exact Mass | 279.89 |
| IUPAC Name | 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1nc(Br)c2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C6H3BrCl2N4/c1-13-5-2(3(7)12-13)4(8)10-6(9)11-5/h1H3 |
| InChIKey | LCNUPXGUFFSKOP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.93 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine?
The IUPAC name of 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine (CID 84715127) is 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine is Cn1nc(Br)c2c(Cl)nc(Cl)nc21.
What is the InChIKey of 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine?
The InChIKey is LCNUPXGUFFSKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrCl2N4/c1-13-5-2(3(7)12-13)4(8)10-6(9)11-5/h1H3.
What are the key properties of 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine?
3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine has a molecular weight of 281.93 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,6-dichloro-1-methylpyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 84715127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).