C14H26N2O4 — CID 84715449
tert-butyl 2-(2-amino-3-methoxy-3-oxopropyl)piperidine-1-carboxylate (PubChem CID 84715449) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is tert-butyl 2-(2-amino-3-methoxy-3-oxopropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-amino-3-methoxy-3-oxopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84715449 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | tert-butyl 2-(2-amino-3-methoxy-3-oxopropyl)piperidine-1-carboxylate |
| SMILES | COC(=O)C(N)CC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O4/c1-14(2,3)20-13(18)16-8-6-5-7-10(16)9-11(15)12(17)19-4/h10-11H,5-9,15H2,1-4H3 |
| InChIKey | UARZMJAITSDITP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |