C11H10BrF3N2O — CID 84715772
1-(8-amino-5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (PubChem CID 84715772) has the molecular formula C11H10BrF3N2O and a molecular weight of 323.11 g/mol. Its IUPAC name is 1-(8-amino-5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(8-amino-5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 84715772 |
| Molecular Formula | C11H10BrF3N2O |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-(8-amino-5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(Br)c2c1CN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C11H10BrF3N2O/c12-8-1-2-9(16)7-5-17(4-3-6(7)8)10(18)11(13,14)15/h1-2H,3-5,16H2 |
| InChIKey | HJAPFJIMYRMXGF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|