C8H12N2O — CID 84716482
2-methyl-4,5,6,7-tetrahydroindazol-6-ol (PubChem CID 84716482) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroindazol-6-ol.
| Compound Name | 2-methyl-4,5,6,7-tetrahydroindazol-6-ol |
|---|---|
| PubChem CID | 84716482 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydroindazol-6-ol |
| SMILES | Cn1cc2c(n1)CC(O)CC2 |
| InChI | InChI=1S/C8H12N2O/c1-10-5-6-2-3-7(11)4-8(6)9-10/h5,7,11H,2-4H2,1H3 |
| InChIKey | WJAFXPGMFSOKFO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |