5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid

C6H7N3O2 — CID 84716502

IUPAC5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid
SMILESO=C(O)C1CCc2cnnn21
InChIInChI=1S/C6H7N3O2/c10-6(11)5-2-1-4-3-7-8-9(4)5/h3,5H,1-2H2,(H,10,11)
InChIKeyYCBASQHWEWFKIM-UHFFFAOYSA-N
MW153.14 g/mol
LogP-0.15
Rot. Bonds1

About 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid

5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid (PubChem CID 84716502) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid.

Molecular Properties

Compound Name5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid
PubChem CID84716502
Molecular FormulaC6H7N3O2
Molecular Weight153.14 g/mol
Exact Mass153.05
IUPAC Name5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid
SMILESO=C(O)C1CCc2cnnn21
InChIInChI=1S/C6H7N3O2/c10-6(11)5-2-1-4-3-7-8-9(4)5/h3,5H,1-2H2,(H,10,11)
InChIKeyYCBASQHWEWFKIM-UHFFFAOYSA-N
XLogP-0.15
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.14
LogP ≤ 5-0.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The IUPAC name of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid (CID 84716502) is 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid.
What is the SMILES notation for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The canonical SMILES for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid is O=C(O)C1CCc2cnnn21.
What is the InChIKey of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The InChIKey is YCBASQHWEWFKIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c10-6(11)5-2-1-4-3-7-8-9(4)5/h3,5H,1-2H2,(H,10,11).
What are the key properties of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid is sourced from PubChem (CID 84716502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).