About 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid
5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid (PubChem CID 84716502) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid |
| PubChem CID | 84716502 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid |
| SMILES | O=C(O)C1CCc2cnnn21 |
| InChI | InChI=1S/C6H7N3O2/c10-6(11)5-2-1-4-3-7-8-9(4)5/h3,5H,1-2H2,(H,10,11) |
| InChIKey | YCBASQHWEWFKIM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The IUPAC name of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid (CID 84716502) is 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid.
What is the SMILES notation for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The canonical SMILES for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid is O=C(O)C1CCc2cnnn21.
What is the InChIKey of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
The InChIKey is YCBASQHWEWFKIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c10-6(11)5-2-1-4-3-7-8-9(4)5/h3,5H,1-2H2,(H,10,11).
What are the key properties of 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid?
5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-pyrrolo[1,2-c]triazole-6-carboxylic acid is sourced from PubChem (CID 84716502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).