About 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde
1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde (PubChem CID 84716725) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde.
Molecular Properties
| Compound Name | 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde |
| PubChem CID | 84716725 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde |
| SMILES | Cn1ccc2ncc(C=O)cc21 |
| InChI | InChI=1S/C9H8N2O/c1-11-3-2-8-9(11)4-7(6-12)5-10-8/h2-6H,1H3 |
| InChIKey | RVHRMACYVHKUFP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde?
The IUPAC name of 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde (CID 84716725) is 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde.
What is the SMILES notation for 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde?
The canonical SMILES for 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde is Cn1ccc2ncc(C=O)cc21.
What is the InChIKey of 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde?
The InChIKey is RVHRMACYVHKUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c1-11-3-2-8-9(11)4-7(6-12)5-10-8/h2-6H,1H3.
What are the key properties of 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde?
1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde has a molecular weight of 160.18 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolo[3,2-b]pyridine-6-carbaldehyde is sourced from PubChem (CID 84716725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).