C7H9F2NO — CID 84716766
5,5-difluoro-1,2,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-3-one (PubChem CID 84716766) has the molecular formula C7H9F2NO and a molecular weight of 161.15 g/mol. Its IUPAC name is 5,5-difluoro-1,2,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-3-one.
| Compound Name | 5,5-difluoro-1,2,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 84716766 |
| Molecular Formula | C7H9F2NO |
| Molecular Weight | 161.15 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 5,5-difluoro-1,2,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-3-one |
| SMILES | O=C1NCC2CC(F)(F)CC12 |
| InChI | InChI=1S/C7H9F2NO/c8-7(9)1-4-3-10-6(11)5(4)2-7/h4-5H,1-3H2,(H,10,11) |
| InChIKey | MTZLMRFCEHVLHC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |