About 1-ethylindazol-7-ol
1-ethylindazol-7-ol (PubChem CID 84716850) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-ethylindazol-7-ol.
Molecular Properties
| Compound Name | 1-ethylindazol-7-ol |
| PubChem CID | 84716850 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-ethylindazol-7-ol |
| SMILES | CCn1ncc2cccc(O)c21 |
| InChI | InChI=1S/C9H10N2O/c1-2-11-9-7(6-10-11)4-3-5-8(9)12/h3-6,12H,2H2,1H3 |
| InChIKey | HCGOODVCGWORMO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylindazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylindazol-7-ol?
The IUPAC name of 1-ethylindazol-7-ol (CID 84716850) is 1-ethylindazol-7-ol.
What is the SMILES notation for 1-ethylindazol-7-ol?
The canonical SMILES for 1-ethylindazol-7-ol is CCn1ncc2cccc(O)c21.
What is the InChIKey of 1-ethylindazol-7-ol?
The InChIKey is HCGOODVCGWORMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-2-11-9-7(6-10-11)4-3-5-8(9)12/h3-6,12H,2H2,1H3.
What are the key properties of 1-ethylindazol-7-ol?
1-ethylindazol-7-ol has a molecular weight of 162.19 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylindazol-7-ol is sourced from PubChem (CID 84716850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).