About 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile
2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile (PubChem CID 84716864) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile |
| PubChem CID | 84716864 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile |
| SMILES | Cn1nc2c(n1)C(C#N)CCC2 |
| InChI | InChI=1S/C8H10N4/c1-12-10-7-4-2-3-6(5-9)8(7)11-12/h6H,2-4H2,1H3 |
| InChIKey | FDENKXDQEOPJPE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile (CID 84716864) is 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile is Cn1nc2c(n1)C(C#N)CCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile?
The InChIKey is FDENKXDQEOPJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-12-10-7-4-2-3-6(5-9)8(7)11-12/h6H,2-4H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile?
2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile has a molecular weight of 162.20 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydrobenzotriazole-4-carbonitrile is sourced from PubChem (CID 84716864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).