C9H12N2O — CID 84716986
4-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 84716986) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | 4-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 84716986 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | COc1ccnc2c1CNCC2 |
| InChI | InChI=1S/C9H12N2O/c1-12-9-3-5-11-8-2-4-10-6-7(8)9/h3,5,10H,2,4,6H2,1H3 |
| InChIKey | OXIXTDMJBNBMPS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |