About 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one
1-ethyl-6,7-dihydro-4H-benzotriazol-5-one (PubChem CID 84717038) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one.
Molecular Properties
| Compound Name | 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one |
| PubChem CID | 84717038 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one |
| SMILES | CCn1nnc2c1CCC(=O)C2 |
| InChI | InChI=1S/C8H11N3O/c1-2-11-8-4-3-6(12)5-7(8)9-10-11/h2-5H2,1H3 |
| InChIKey | MMGBRCWDYYQITQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one?
The IUPAC name of 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one (CID 84717038) is 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one.
What is the SMILES notation for 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one?
The canonical SMILES for 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one is CCn1nnc2c1CCC(=O)C2.
What is the InChIKey of 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one?
The InChIKey is MMGBRCWDYYQITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-2-11-8-4-3-6(12)5-7(8)9-10-11/h2-5H2,1H3.
What are the key properties of 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one?
1-ethyl-6,7-dihydro-4H-benzotriazol-5-one has a molecular weight of 165.20 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6,7-dihydro-4H-benzotriazol-5-one is sourced from PubChem (CID 84717038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).