C10H12FN — CID 84717063
4-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 84717063) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 4-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 84717063 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc2c(c1)C(F)CNC2 |
| InChI | InChI=1S/C10H12FN/c1-7-2-3-8-5-12-6-10(11)9(8)4-7/h2-4,10,12H,5-6H2,1H3 |
| InChIKey | SAYRWMZDPRGTIC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |