About 3-fluoro-3-phenyloxolane
3-fluoro-3-phenyloxolane (PubChem CID 84717126) has the molecular formula C10H11FO
and a molecular weight of 166.19 g/mol. Its IUPAC name is 3-fluoro-3-phenyloxolane.
Molecular Properties
| Compound Name | 3-fluoro-3-phenyloxolane |
| PubChem CID | 84717126 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 3-fluoro-3-phenyloxolane |
| SMILES | FC1(c2ccccc2)CCOC1 |
| InChI | InChI=1S/C10H11FO/c11-10(6-7-12-8-10)9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | OKKVSMRESIOFIB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-3-phenyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-phenyloxolane?
The IUPAC name of 3-fluoro-3-phenyloxolane (CID 84717126) is 3-fluoro-3-phenyloxolane.
What is the SMILES notation for 3-fluoro-3-phenyloxolane?
The canonical SMILES for 3-fluoro-3-phenyloxolane is FC1(c2ccccc2)CCOC1.
What is the InChIKey of 3-fluoro-3-phenyloxolane?
The InChIKey is OKKVSMRESIOFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO/c11-10(6-7-12-8-10)9-4-2-1-3-5-9/h1-5H,6-8H2.
What are the key properties of 3-fluoro-3-phenyloxolane?
3-fluoro-3-phenyloxolane has a molecular weight of 166.19 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-phenyloxolane is sourced from PubChem (CID 84717126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).