C9H14N2O — CID 84717143
2,3-dimethyl-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 84717143) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,3-dimethyl-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 2,3-dimethyl-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 84717143 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2,3-dimethyl-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | Cc1c2c(nn1C)CCCC2O |
| InChI | InChI=1S/C9H14N2O/c1-6-9-7(10-11(6)2)4-3-5-8(9)12/h8,12H,3-5H2,1-2H3 |
| InChIKey | YBUVQLGNWWARDL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |