About 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile
1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 84717441) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile |
| PubChem CID | 84717441 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile |
| SMILES | Cc1nn(C)c2cc(C#N)cnc12 |
| InChI | InChI=1S/C9H8N4/c1-6-9-8(13(2)12-6)3-7(4-10)5-11-9/h3,5H,1-2H3 |
| InChIKey | RQDVZRZWLHDOAY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile (CID 84717441) is 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile is Cc1nn(C)c2cc(C#N)cnc12.
What is the InChIKey of 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is RQDVZRZWLHDOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-6-9-8(13(2)12-6)3-7(4-10)5-11-9/h3,5H,1-2H3.
What are the key properties of 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile?
1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 172.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazolo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 84717441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).