About 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one
4-(1-aminoethyl)-2,3-dihydroisoindol-1-one (PubChem CID 84717756) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 84717756 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one |
| SMILES | CC(N)c1cccc2c1CNC2=O |
| InChI | InChI=1S/C10H12N2O/c1-6(11)7-3-2-4-8-9(7)5-12-10(8)13/h2-4,6H,5,11H2,1H3,(H,12,13) |
| InChIKey | IWKJWMMIUPWPHM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one (CID 84717756) is 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one is CC(N)c1cccc2c1CNC2=O.
What is the InChIKey of 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one?
The InChIKey is IWKJWMMIUPWPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-6(11)7-3-2-4-8-9(7)5-12-10(8)13/h2-4,6H,5,11H2,1H3,(H,12,13).
What are the key properties of 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one?
4-(1-aminoethyl)-2,3-dihydroisoindol-1-one has a molecular weight of 176.22 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminoethyl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 84717756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).