About 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine
7-fluoro-3-methyl-2,4-dihydrochromen-3-amine (PubChem CID 84718496) has the molecular formula C10H12FNO
and a molecular weight of 181.21 g/mol. Its IUPAC name is 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine.
Molecular Properties
| Compound Name | 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine |
| PubChem CID | 84718496 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine |
| SMILES | CC1(N)COc2cc(F)ccc2C1 |
| InChI | InChI=1S/C10H12FNO/c1-10(12)5-7-2-3-8(11)4-9(7)13-6-10/h2-4H,5-6,12H2,1H3 |
| InChIKey | PLFVSDKINWSAQX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine?
The IUPAC name of 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine (CID 84718496) is 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine.
What is the SMILES notation for 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine?
The canonical SMILES for 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine is CC1(N)COc2cc(F)ccc2C1.
What is the InChIKey of 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine?
The InChIKey is PLFVSDKINWSAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO/c1-10(12)5-7-2-3-8(11)4-9(7)13-6-10/h2-4H,5-6,12H2,1H3.
What are the key properties of 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine?
7-fluoro-3-methyl-2,4-dihydrochromen-3-amine has a molecular weight of 181.21 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-methyl-2,4-dihydrochromen-3-amine is sourced from PubChem (CID 84718496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).