C9H9ClFN — CID 84718966
7-chloro-3-fluoro-1,2,3,4-tetrahydroquinoline (PubChem CID 84718966) has the molecular formula C9H9ClFN and a molecular weight of 185.63 g/mol. Its IUPAC name is 7-chloro-3-fluoro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-chloro-3-fluoro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 84718966 |
| Molecular Formula | C9H9ClFN |
| Molecular Weight | 185.63 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 7-chloro-3-fluoro-1,2,3,4-tetrahydroquinoline |
| SMILES | FC1CNc2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C9H9ClFN/c10-7-2-1-6-3-8(11)5-12-9(6)4-7/h1-2,4,8,12H,3,5H2 |
| InChIKey | HBYNYRKXEWRXTB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.63 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |